C22H34O4 — CID 155929227
[(2R)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[(3R)-5-oxooxolan-3-yl]but-3-enyl] acetate (PubChem CID 155929227) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(2R)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[(3R)-5-oxooxolan-3-yl]but-3-enyl] acetate.
| Compound Name | [(2R)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[(3R)-5-oxooxolan-3-yl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 155929227 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(2R)-3-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[(3R)-5-oxooxolan-3-yl]but-3-enyl] acetate |
| SMILES | C=C([C@H]1CC[C@H]2C(C)(C)CCC[C@]12C)[C@H](COC(C)=O)[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C22H34O4/c1-14(17(13-25-15(2)23)16-11-20(24)26-12-16)18-7-8-19-21(3,4)9-6-10-22(18,19)5/h16-19H,1,6-13H2,2-5H3/t16-,17-,18+,19-,22+/m0/s1 |
| InChIKey | YSVPPISDEFLICG-KSSXRGRSSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|