About 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane
4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane (PubChem CID 155929611) has the molecular formula C12H27FN2O2S
and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane.
Molecular Properties
| Compound Name | 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane |
| PubChem CID | 155929611 |
| Molecular Formula | C12H27FN2O2S |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane |
| SMILES | CNS(=O)(=O)N(C)C(C)CC(C)(F)CCC(C)C |
| InChI | InChI=1S/C12H27FN2O2S/c1-10(2)7-8-12(4,13)9-11(3)15(6)18(16,17)14-5/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | QRSQRVPGKLZFFM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane?
The IUPAC name of 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane (CID 155929611) is 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane.
What is the SMILES notation for 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane?
The canonical SMILES for 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane is CNS(=O)(=O)N(C)C(C)CC(C)(F)CCC(C)C.
What is the InChIKey of 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane?
The InChIKey is QRSQRVPGKLZFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27FN2O2S/c1-10(2)7-8-12(4,13)9-11(3)15(6)18(16,17)14-5/h10-11,14H,7-9H2,1-6H3.
What are the key properties of 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane?
4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane has a molecular weight of 282.43 g/mol, XLogP of 2.33, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4,7-dimethyl-2-[methyl(methylsulfamoyl)amino]octane is sourced from PubChem (CID 155929611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).