C20H36OSi2 — CID 155929750
(E,4R)-7,7-dimethyl-9-triethylsilyl-1-trimethylsilylnon-5-en-1,8-diyn-4-ol (PubChem CID 155929750) has the molecular formula C20H36OSi2 and a molecular weight of 348.68 g/mol. Its IUPAC name is (E,4R)-7,7-dimethyl-9-triethylsilyl-1-trimethylsilylnon-5-en-1,8-diyn-4-ol.
| Compound Name | (E,4R)-7,7-dimethyl-9-triethylsilyl-1-trimethylsilylnon-5-en-1,8-diyn-4-ol |
|---|---|
| PubChem CID | 155929750 |
| Molecular Formula | C20H36OSi2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (E,4R)-7,7-dimethyl-9-triethylsilyl-1-trimethylsilylnon-5-en-1,8-diyn-4-ol |
| SMILES | CC[Si](C#CC(C)(C)/C=C/[C@H](O)CC#C[Si](C)(C)C)(CC)CC |
| InChI | InChI=1S/C20H36OSi2/c1-9-23(10-2,11-3)18-16-20(4,5)15-14-19(21)13-12-17-22(6,7)8/h14-15,19,21H,9-11,13H2,1-8H3/b15-14+/t19-/m1/s1 |
| InChIKey | HIHUDTFOGAXBFR-JUWJPQTCSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|