C13H16O — CID 155929906
(1S,3R,4S,7S,12R)-3-ethenyl-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene (PubChem CID 155929906) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (1S,3R,4S,7S,12R)-3-ethenyl-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene.
| Compound Name | (1S,3R,4S,7S,12R)-3-ethenyl-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene |
|---|---|
| PubChem CID | 155929906 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (1S,3R,4S,7S,12R)-3-ethenyl-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene |
| SMILES | C=C[C@H]1C[C@H]2C=CCO[C@H]3C=C[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C13H16O/c1-2-9-8-10-4-3-7-14-12-6-5-11(9)13(10)12/h2-6,9-13H,1,7-8H2/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | WFZLUXDDGWONCC-FPYNETTCSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|