C15H16O — CID 155930082
(2R,3R,8R,10R)-pentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-dien-9-one (PubChem CID 155930082) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R,3R,8R,10R)-pentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-dien-9-one.
| Compound Name | (2R,3R,8R,10R)-pentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-dien-9-one |
|---|---|
| PubChem CID | 155930082 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2R,3R,8R,10R)-pentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-dien-9-one |
| SMILES | O=C1[C@@H]2C3C=CC(C3)[C@@H]2[C@H]2C3C=CC(C3)[C@@H]12 |
| InChI | InChI=1S/C15H16O/c16-15-13-9-3-1-7(5-9)11(13)12-8-2-4-10(6-8)14(12)15/h1-4,7-14H,5-6H2/t7?,8?,9?,10?,11-,12-,13-,14-/m1/s1 |
| InChIKey | ZLXHZSNEHVHERY-AHWPSJJYSA-N |
| XLogP | 2.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|