C11H18O2 — CID 155930140
(2S,3aR,6aS)-2-hydroxy-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 155930140) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2S,3aR,6aS)-2-hydroxy-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (2S,3aR,6aS)-2-hydroxy-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 155930140 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2S,3aR,6aS)-2-hydroxy-4,4,6a-trimethyl-3,3a,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | CC1(C)CC[C@]2(C)C(=O)[C@@H](O)C[C@H]12 |
| InChI | InChI=1S/C11H18O2/c1-10(2)4-5-11(3)8(10)6-7(12)9(11)13/h7-8,12H,4-6H2,1-3H3/t7-,8+,11-/m0/s1 |
| InChIKey | FZBRZQSOCDMCSA-RNSXUZJQSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |