C21H36O5Si — CID 155930331
(5S,6R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one (PubChem CID 155930331) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (5S,6R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one.
| Compound Name | (5S,6R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one |
|---|---|
| PubChem CID | 155930331 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (5S,6R,8R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one |
| SMILES | COC1(OC)C(=O)C23C=C[C@H]1C[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)CCC3O |
| InChI | InChI=1S/C21H36O5Si/c1-19(2,3)27(6,7)26-13-14-8-9-17(22)20-11-10-15(12-16(14)20)21(24-4,25-5)18(20)23/h10-11,14-17,22H,8-9,12-13H2,1-7H3/t14-,15+,16-,17?,20?/m1/s1 |
| InChIKey | ZKFXPLNSGOCHRX-HNOGJWCXSA-N |
| XLogP | 3.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|