C12H12FNO3 — CID 155930335
(6R,7S,7aR)-7-(4-fluorophenyl)-6-hydroxy-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 155930335) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is (6R,7S,7aR)-7-(4-fluorophenyl)-6-hydroxy-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (6R,7S,7aR)-7-(4-fluorophenyl)-6-hydroxy-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 155930335 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (6R,7S,7aR)-7-(4-fluorophenyl)-6-hydroxy-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1OC[C@H]2[C@H](c3ccc(F)cc3)[C@@H](O)CN12 |
| InChI | InChI=1S/C12H12FNO3/c13-8-3-1-7(2-4-8)11-9-6-17-12(16)14(9)5-10(11)15/h1-4,9-11,15H,5-6H2/t9-,10-,11-/m0/s1 |
| InChIKey | DKPJYBLZQQRPGJ-DCAQKATOSA-N |
| XLogP | 1.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |