C22H18F7NO3 — CID 155930337
(6R,7S,7aR)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 155930337) has the molecular formula C22H18F7NO3 and a molecular weight of 477.38 g/mol. Its IUPAC name is (6R,7S,7aR)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (6R,7S,7aR)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 155930337 |
| Molecular Formula | C22H18F7NO3 |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (6R,7S,7aR)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)OC[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F7NO3/c1-11(13-6-14(21(24,25)26)8-15(7-13)22(27,28)29)33-18-9-30-17(10-32-20(30)31)19(18)12-2-4-16(23)5-3-12/h2-8,11,17-19H,9-10H2,1H3/t11-,17+,18+,19+/m1/s1 |
| InChIKey | KYYSNBZUYLSHJY-VNNGDKDKSA-N |
| XLogP | 5.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |