C14H15BrN2 — CID 155930435
7-bromo-5,10-dimethyl-2,3-dihydro-1H-azepino[3,4-b]indole (PubChem CID 155930435) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 7-bromo-5,10-dimethyl-2,3-dihydro-1H-azepino[3,4-b]indole.
| Compound Name | 7-bromo-5,10-dimethyl-2,3-dihydro-1H-azepino[3,4-b]indole |
|---|---|
| PubChem CID | 155930435 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 7-bromo-5,10-dimethyl-2,3-dihydro-1H-azepino[3,4-b]indole |
| SMILES | CC1=CCNCc2c1c1cc(Br)ccc1n2C |
| InChI | InChI=1S/C14H15BrN2/c1-9-5-6-16-8-13-14(9)11-7-10(15)3-4-12(11)17(13)2/h3-5,7,16H,6,8H2,1-2H3 |
| InChIKey | MHAOVMRDMJSNFE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |