About 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine
1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine (PubChem CID 155930613) has the molecular formula C31H25N
and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine.
Molecular Properties
| Compound Name | 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine |
| PubChem CID | 155930613 |
| Molecular Formula | C31H25N |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine |
| SMILES | Cc1ccc2c3ccc(C)c4c(C)cc(/N=C/c5ccccc5)c(c5ccc(C)c1c25)c43 |
| InChI | InChI=1S/C31H25N/c1-18-10-13-23-24-14-11-20(3)28-21(4)16-26(32-17-22-8-6-5-7-9-22)30(31(24)28)25-15-12-19(2)27(18)29(23)25/h5-17H,1-4H3/b32-17+ |
| InChIKey | DLEVKLSFEHNKSJ-VTNSRFBWSA-N |
| XLogP | 8.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine?
The IUPAC name of 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine (CID 155930613) is 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine.
What is the SMILES notation for 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine?
The canonical SMILES for 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine is Cc1ccc2c3ccc(C)c4c(C)cc(/N=C/c5ccccc5)c(c5ccc(C)c1c25)c43.
What is the InChIKey of 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine?
The InChIKey is DLEVKLSFEHNKSJ-VTNSRFBWSA-N. The full InChI is InChI=1S/C31H25N/c1-18-10-13-23-24-14-11-20(3)28-21(4)16-26(32-17-22-8-6-5-7-9-22)30(31(24)28)25-15-12-19(2)27(18)29(23)25/h5-17H,1-4H3/b32-17+.
What are the key properties of 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine?
1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine has a molecular weight of 411.55 g/mol, XLogP of 8.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-(3,4,9,10-tetramethylperylen-1-yl)methanimine is sourced from PubChem (CID 155930613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).