C13H14FNO5S — CID 155931029
methyl (3aS,4S,6S,6aR)-6-(3-fluorophenyl)-1,1-dioxo-3,3a,4,5,6,6a-hexahydrooxathiolo[3,4-c]pyrrole-4-carboxylate (PubChem CID 155931029) has the molecular formula C13H14FNO5S and a molecular weight of 315.32 g/mol. Its IUPAC name is methyl (3aS,4S,6S,6aR)-6-(3-fluorophenyl)-1,1-dioxo-3,3a,4,5,6,6a-hexahydrooxathiolo[3,4-c]pyrrole-4-carboxylate.
| Compound Name | methyl (3aS,4S,6S,6aR)-6-(3-fluorophenyl)-1,1-dioxo-3,3a,4,5,6,6a-hexahydrooxathiolo[3,4-c]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 155931029 |
| Molecular Formula | C13H14FNO5S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | methyl (3aS,4S,6S,6aR)-6-(3-fluorophenyl)-1,1-dioxo-3,3a,4,5,6,6a-hexahydrooxathiolo[3,4-c]pyrrole-4-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2cccc(F)c2)[C@H]2[C@@H]1COS2(=O)=O |
| InChI | InChI=1S/C13H14FNO5S/c1-19-13(16)11-9-6-20-21(17,18)12(9)10(15-11)7-3-2-4-8(14)5-7/h2-5,9-12,15H,6H2,1H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | CCDARXCNYFMFLR-NOOOWODRSA-N |
| XLogP | 0.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|