C25H38O4Si — CID 155931118
(1R,3S,8S,10S)-8,12,15,15-tetramethyl-10-triethylsilyloxytricyclo[9.3.1.03,8]pentadeca-5,11-diene-2,4,13-trione (PubChem CID 155931118) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (1R,3S,8S,10S)-8,12,15,15-tetramethyl-10-triethylsilyloxytricyclo[9.3.1.03,8]pentadeca-5,11-diene-2,4,13-trione.
| Compound Name | (1R,3S,8S,10S)-8,12,15,15-tetramethyl-10-triethylsilyloxytricyclo[9.3.1.03,8]pentadeca-5,11-diene-2,4,13-trione |
|---|---|
| PubChem CID | 155931118 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (1R,3S,8S,10S)-8,12,15,15-tetramethyl-10-triethylsilyloxytricyclo[9.3.1.03,8]pentadeca-5,11-diene-2,4,13-trione |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@]2(C)CC=CC(=O)[C@H]2C(=O)[C@@H]2CC(=O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C25H38O4Si/c1-8-30(9-2,10-3)29-20-15-25(7)13-11-12-18(26)22(25)23(28)17-14-19(27)16(4)21(20)24(17,5)6/h11-12,17,20,22H,8-10,13-15H2,1-7H3/t17-,20-,22-,25-/m0/s1 |
| InChIKey | IJFCZOZOISOOPK-SHDZPMAFSA-N |
| XLogP | 5.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|