About (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol
(E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol (PubChem CID 155931170) has the molecular formula C10H8F4O
and a molecular weight of 220.16 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol |
| PubChem CID | 155931170 |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol |
| SMILES | OC(/C=C/c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C10H8F4O/c11-8-4-2-1-3-7(8)5-6-9(15)10(12,13)14/h1-6,9,15H/b6-5+ |
| InChIKey | ORLSSVVSXJQTSR-AATRIKPKSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol?
The IUPAC name of (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol (CID 155931170) is (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol.
What is the SMILES notation for (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol?
The canonical SMILES for (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol is OC(/C=C/c1ccccc1F)C(F)(F)F.
What is the InChIKey of (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol?
The InChIKey is ORLSSVVSXJQTSR-AATRIKPKSA-N. The full InChI is InChI=1S/C10H8F4O/c11-8-4-2-1-3-7(8)5-6-9(15)10(12,13)14/h1-6,9,15H/b6-5+.
What are the key properties of (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol?
(E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol has a molecular weight of 220.16 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1-trifluoro-4-(2-fluorophenyl)but-3-en-2-ol is sourced from PubChem (CID 155931170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).