About 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate
4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate (PubChem CID 155931206) has the molecular formula C14H26O6Si
and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate |
| PubChem CID | 155931206 |
| Molecular Formula | C14H26O6Si |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate |
| SMILES | CCOC(=O)C(=O)C(C)(O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H26O6Si/c1-9-19-11(16)10(15)14(5,12(17)18-6)20-21(7,8)13(2,3)4/h9H2,1-8H3 |
| InChIKey | SIXNRWVPSHPFMU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate (CID 155931206) is 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate is CCOC(=O)C(=O)C(C)(O[Si](C)(C)C(C)(C)C)C(=O)OC.
What is the InChIKey of 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate?
The InChIKey is SIXNRWVPSHPFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6Si/c1-9-19-11(16)10(15)14(5,12(17)18-6)20-21(7,8)13(2,3)4/h9H2,1-8H3.
What are the key properties of 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate?
4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate has a molecular weight of 318.44 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxobutanedioate is sourced from PubChem (CID 155931206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).