C31H27NO3 — CID 155931214
(9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-6,7-dimethoxy-9,10-dihydrophenanthren-9-ol (PubChem CID 155931214) has the molecular formula C31H27NO3 and a molecular weight of 461.56 g/mol. Its IUPAC name is (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-6,7-dimethoxy-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-6,7-dimethoxy-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 155931214 |
| Molecular Formula | C31H27NO3 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (9R,10S)-10-[(E)-2-(benzhydrylideneamino)ethenyl]-6,7-dimethoxy-9,10-dihydrophenanthren-9-ol |
| SMILES | COc1cc2c(cc1OC)[C@H](O)[C@@H](/C=C/N=C(c1ccccc1)c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C31H27NO3/c1-34-28-19-26-24-16-10-9-15-23(24)25(31(33)27(26)20-29(28)35-2)17-18-32-30(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-20,25,31,33H,1-2H3/b18-17+/t25-,31+/m0/s1 |
| InChIKey | OPTDNYQXSXFSHB-WDVOLENISA-N |
| XLogP | 6.55 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|