C9H8F2N2O4 — CID 155931602
1-[(1R,2R)-1,2-difluoropropyl]-3,5-dinitrobenzene (PubChem CID 155931602) has the molecular formula C9H8F2N2O4 and a molecular weight of 246.17 g/mol. Its IUPAC name is 1-[(1R,2R)-1,2-difluoropropyl]-3,5-dinitrobenzene.
| Compound Name | 1-[(1R,2R)-1,2-difluoropropyl]-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 155931602 |
| Molecular Formula | C9H8F2N2O4 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-[(1R,2R)-1,2-difluoropropyl]-3,5-dinitrobenzene |
| SMILES | C[C@@H](F)[C@H](F)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8F2N2O4/c1-5(10)9(11)6-2-7(12(14)15)4-8(3-6)13(16)17/h2-5,9H,1H3/t5-,9+/m1/s1 |
| InChIKey | SIHLZTOJZLVENV-ANLVUFKYSA-N |
| XLogP | 2.87 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|