C13H14O6 — CID 155931781
(E)-3-[2-(hydroxymethyl)-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoic acid (PubChem CID 155931781) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is (E)-3-[2-(hydroxymethyl)-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-3-[2-(hydroxymethyl)-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 155931781 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (E)-3-[2-(hydroxymethyl)-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C(=C/C(=O)O)C1=C(CO)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C13H14O6/c1-6-7(2)13(18)11(8(5-14)12(6)17)9(19-3)4-10(15)16/h4,14H,5H2,1-3H3,(H,15,16)/b9-4+ |
| InChIKey | BLKAERZDPDGJPZ-RUDMXATFSA-N |
| XLogP | 0.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|