C29H42O9Si — CID 155931925
trimethyl 1-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 155931925) has the molecular formula C29H42O9Si and a molecular weight of 562.73 g/mol. Its IUPAC name is trimethyl 1-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | trimethyl 1-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 155931925 |
| Molecular Formula | C29H42O9Si |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | trimethyl 1-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1OC2(CC/C(C)=C/[C@H](C)Cc3ccccc3)CCC(C(=O)OC)(O2)C1(O[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C29H42O9Si/c1-20(18-21(2)19-22-12-10-9-11-13-22)14-15-27-16-17-28(37-27,25(31)34-4)29(26(32)35-5,38-39(6,7)8)23(36-27)24(30)33-3/h9-13,18,21,23H,14-17,19H2,1-8H3/b20-18+/t21-,23?,27?,28?,29?/m0/s1 |
| InChIKey | WNLMPYBICOWIJF-AKTUQEJYSA-N |
| XLogP | 4.35 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|