C39H56O12Si2 — CID 155932144
5-O-ethyl 4-O-methyl (6R,7S)-6,7-diacetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[2-(methoxymethoxy)ethyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylate (PubChem CID 155932144) has the molecular formula C39H56O12Si2 and a molecular weight of 773.04 g/mol. Its IUPAC name is 5-O-ethyl 4-O-methyl (6R,7S)-6,7-diacetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[2-(methoxymethoxy)ethyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylate.
| Compound Name | 5-O-ethyl 4-O-methyl (6R,7S)-6,7-diacetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[2-(methoxymethoxy)ethyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 155932144 |
| Molecular Formula | C39H56O12Si2 |
| Molecular Weight | 773.04 g/mol |
| Exact Mass | 772.33 |
| IUPAC Name | 5-O-ethyl 4-O-methyl (6R,7S)-6,7-diacetyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[2-(methoxymethoxy)ethyl]-4-trimethylsilyloxy-2,8-dioxabicyclo[3.2.1]octane-4,5-dicarboxylate |
| SMILES | CCOC(=O)C12OC(CCOCOC)(OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C1(O[Si](C)(C)C)C(=O)OC)[C@H](C(C)=O)[C@H]2C(C)=O |
| InChI | InChI=1S/C39H56O12Si2/c1-12-47-35(43)39-33(28(3)41)32(27(2)40)37(50-39,23-24-46-26-44-7)49-31(38(39,34(42)45-8)51-52(9,10)11)25-48-53(36(4,5)6,29-19-15-13-16-20-29)30-21-17-14-18-22-30/h13-22,31-33H,12,23-26H2,1-11H3/t31?,32-,33-,37?,38?,39?/m1/s1 |
| InChIKey | WCQURLMEOXWIKX-WCAXCCTLSA-N |
| XLogP | 4.17 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.04 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|