About (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide
(3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide (PubChem CID 155932175) has the molecular formula C9H17INO2S+
and a molecular weight of 330.21 g/mol. Its IUPAC name is (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide.
Molecular Properties
| Compound Name | (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide |
| PubChem CID | 155932175 |
| Molecular Formula | C9H17INO2S+ |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide |
| SMILES | C[C@@H]1C[C@]2(C[I+]2)N(C(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C9H17INO2S/c1-7-5-9(6-10-9)11(8(2,3)4)14(7,12)13/h7H,5-6H2,1-4H3/q+1/t7-,9-/m1/s1 |
| InChIKey | SLKRMPLDWFFRFX-VXNVDRBHSA-N |
| XLogP | -1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide?
The IUPAC name of (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide (CID 155932175) is (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide.
What is the SMILES notation for (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide?
The canonical SMILES for (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide is C[C@@H]1C[C@]2(C[I+]2)N(C(C)(C)C)S1(=O)=O.
What is the InChIKey of (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide?
The InChIKey is SLKRMPLDWFFRFX-VXNVDRBHSA-N. The full InChI is InChI=1S/C9H17INO2S/c1-7-5-9(6-10-9)11(8(2,3)4)14(7,12)13/h7H,5-6H2,1-4H3/q+1/t7-,9-/m1/s1.
What are the key properties of (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide?
(3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide has a molecular weight of 330.21 g/mol, XLogP of -1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-7-tert-butyl-5-methyl-1-iodonia-6λ6-thia-7-azaspiro[2.4]heptane 6,6-dioxide is sourced from PubChem (CID 155932175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).