C26H36O2S — CID 155932272
2,6-ditert-butyl-4-[(R)-[(2S)-oxan-2-yl]sulfanyl-phenylmethyl]phenol (PubChem CID 155932272) has the molecular formula C26H36O2S and a molecular weight of 412.64 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(R)-[(2S)-oxan-2-yl]sulfanyl-phenylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(R)-[(2S)-oxan-2-yl]sulfanyl-phenylmethyl]phenol |
|---|---|
| PubChem CID | 155932272 |
| Molecular Formula | C26H36O2S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2,6-ditert-butyl-4-[(R)-[(2S)-oxan-2-yl]sulfanyl-phenylmethyl]phenol |
| SMILES | CC(C)(C)c1cc([C@H](S[C@H]2CCCCO2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H36O2S/c1-25(2,3)20-16-19(17-21(23(20)27)26(4,5)6)24(18-12-8-7-9-13-18)29-22-14-10-11-15-28-22/h7-9,12-13,16-17,22,24,27H,10-11,14-15H2,1-6H3/t22-,24+/m0/s1 |
| InChIKey | ZHUXPIZFWPWUKC-LADGPHEKSA-N |
| XLogP | 7.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |