C32H48O9Si — CID 155932394
trimethyl 5-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-2-triethylsilyloxy-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate (PubChem CID 155932394) has the molecular formula C32H48O9Si and a molecular weight of 604.81 g/mol. Its IUPAC name is trimethyl 5-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-2-triethylsilyloxy-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate.
| Compound Name | trimethyl 5-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-2-triethylsilyloxy-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
|---|---|
| PubChem CID | 155932394 |
| Molecular Formula | C32H48O9Si |
| Molecular Weight | 604.81 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | trimethyl 5-[(E,5R)-3,5-dimethyl-6-phenylhex-3-enyl]-2-triethylsilyloxy-6,8-dioxabicyclo[3.2.1]octane-1,2,7-tricarboxylate |
| SMILES | CC[Si](CC)(CC)OC1(C(=O)OC)CCC2(CC/C(C)=C/[C@H](C)Cc3ccccc3)OC(C(=O)OC)C1(C(=O)OC)O2 |
| InChI | InChI=1S/C32H48O9Si/c1-9-42(10-2,11-3)41-31(28(34)37-7)20-19-30(39-26(27(33)36-6)32(31,40-30)29(35)38-8)18-17-23(4)21-24(5)22-25-15-13-12-14-16-25/h12-16,21,24,26H,9-11,17-20,22H2,1-8H3/b23-21+/t24-,26?,30?,31?,32?/m0/s1 |
| InChIKey | CJGFFJMABSABAP-UVZQLMEUSA-N |
| XLogP | 5.52 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|