C32H42O8S — CID 155932492
[(3R,6S)-4,5-diacetyloxy-6-[(R)-(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]sulfanyloxan-3-yl] acetate (PubChem CID 155932492) has the molecular formula C32H42O8S and a molecular weight of 586.75 g/mol. Its IUPAC name is [(3R,6S)-4,5-diacetyloxy-6-[(R)-(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]sulfanyloxan-3-yl] acetate.
| Compound Name | [(3R,6S)-4,5-diacetyloxy-6-[(R)-(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]sulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 155932492 |
| Molecular Formula | C32H42O8S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | [(3R,6S)-4,5-diacetyloxy-6-[(R)-(3,5-ditert-butyl-4-hydroxyphenyl)-phenylmethyl]sulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](S[C@H](c2ccccc2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H42O8S/c1-18(33)38-25-17-37-30(28(40-20(3)35)27(25)39-19(2)34)41-29(21-13-11-10-12-14-21)22-15-23(31(4,5)6)26(36)24(16-22)32(7,8)9/h10-16,25,27-30,36H,17H2,1-9H3/t25-,27?,28?,29-,30+/m1/s1 |
| InChIKey | YONVDBVMNAYLDX-XVLRFGCZSA-N |
| XLogP | 5.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|