C35H60N2O6Si2 — CID 155932590
dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-9-phenyl-3-triethylsilyloxynon-6-enyl]-2-triethylsilyloxybutanedioate (PubChem CID 155932590) has the molecular formula C35H60N2O6Si2 and a molecular weight of 661.05 g/mol. Its IUPAC name is dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-9-phenyl-3-triethylsilyloxynon-6-enyl]-2-triethylsilyloxybutanedioate.
| Compound Name | dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-9-phenyl-3-triethylsilyloxynon-6-enyl]-2-triethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 155932590 |
| Molecular Formula | C35H60N2O6Si2 |
| Molecular Weight | 661.05 g/mol |
| Exact Mass | 660.40 |
| IUPAC Name | dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-9-phenyl-3-triethylsilyloxynon-6-enyl]-2-triethylsilyloxybutanedioate |
| SMILES | CC[Si](CC)(CC)OC(CC/C(C)=C/[C@H](C)Cc1ccccc1)CC[C@](O[Si](CC)(CC)CC)(C(=O)OC)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C35H60N2O6Si2/c1-11-44(12-2,13-3)42-31(23-22-28(7)26-29(8)27-30-20-18-17-19-21-30)24-25-35(34(39)41-10,32(37-36)33(38)40-9)43-45(14-4,15-5)16-6/h17-21,26,29,31H,11-16,22-25,27H2,1-10H3/b28-26+/t29-,31?,35+/m0/s1 |
| InChIKey | YEYZUEKXTJWFRG-UESKLPAHSA-N |
| XLogP | 8.54 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.05 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|