About ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate
ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate (PubChem CID 155932774) has the molecular formula C12H18O6
and a molecular weight of 258.27 g/mol. Its IUPAC name is ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate |
| PubChem CID | 155932774 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)C1OC(C)(C)O[C@H]1C(C)=O |
| InChI | InChI=1S/C12H18O6/c1-5-16-9(15)6-8(14)11-10(7(2)13)17-12(3,4)18-11/h10-11H,5-6H2,1-4H3/t10-,11?/m0/s1 |
| InChIKey | DKFIBEDGEPRQFS-VUWPPUDQSA-N |
| XLogP | 0.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate?
The IUPAC name of ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate (CID 155932774) is ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate is CCOC(=O)CC(=O)C1OC(C)(C)O[C@H]1C(C)=O.
What is the InChIKey of ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate?
The InChIKey is DKFIBEDGEPRQFS-VUWPPUDQSA-N. The full InChI is InChI=1S/C12H18O6/c1-5-16-9(15)6-8(14)11-10(7(2)13)17-12(3,4)18-11/h10-11H,5-6H2,1-4H3/t10-,11?/m0/s1.
What are the key properties of ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate?
ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate has a molecular weight of 258.27 g/mol, XLogP of 0.62, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropanoate is sourced from PubChem (CID 155932774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).