C19H26F9NO5 — CID 155932788
tert-butyl (2S)-2-[3-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethoxy]-3-oxopropyl]piperidine-1-carboxylate (PubChem CID 155932788) has the molecular formula C19H26F9NO5 and a molecular weight of 519.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethoxy]-3-oxopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethoxy]-3-oxopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155932788 |
| Molecular Formula | C19H26F9NO5 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | tert-butyl (2S)-2-[3-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethoxy]-3-oxopropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CCC(=O)OCCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H26F9NO5/c1-15(2,3)34-14(31)29-9-5-4-6-12(29)7-8-13(30)32-10-11-33-16(17(20,21)22,18(23,24)25)19(26,27)28/h12H,4-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | HCLIRBBSRGYKAT-LBPRGKRZSA-N |
| XLogP | 5.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|