C20H33FN2O4 — CID 155933217
(1S,2S,3aS,6R,6aR)-2-acetamido-N-tert-butyl-6-fluoro-5,5-dimethoxy-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide (PubChem CID 155933217) has the molecular formula C20H33FN2O4 and a molecular weight of 384.49 g/mol. Its IUPAC name is (1S,2S,3aS,6R,6aR)-2-acetamido-N-tert-butyl-6-fluoro-5,5-dimethoxy-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide.
| Compound Name | (1S,2S,3aS,6R,6aR)-2-acetamido-N-tert-butyl-6-fluoro-5,5-dimethoxy-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
|---|---|
| PubChem CID | 155933217 |
| Molecular Formula | C20H33FN2O4 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (1S,2S,3aS,6R,6aR)-2-acetamido-N-tert-butyl-6-fluoro-5,5-dimethoxy-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
| SMILES | C=CC[C@H]1[C@H]2[C@H](CC(OC)(OC)[C@@H]2F)C[C@@]1(NC(C)=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H33FN2O4/c1-8-9-14-15-13(11-20(26-6,27-7)16(15)21)10-19(14,22-12(2)24)17(25)23-18(3,4)5/h8,13-16H,1,9-11H2,2-7H3,(H,22,24)(H,23,25)/t13-,14-,15+,16+,19-/m0/s1 |
| InChIKey | UNVFTKYSXVLYCE-DBDOFBCQSA-N |
| XLogP | 2.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|