C18H28N2O3 — CID 155933220
(1S,2S,3aS,6aR)-2-acetamido-N-tert-butyl-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide (PubChem CID 155933220) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1S,2S,3aS,6aR)-2-acetamido-N-tert-butyl-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide.
| Compound Name | (1S,2S,3aS,6aR)-2-acetamido-N-tert-butyl-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
|---|---|
| PubChem CID | 155933220 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (1S,2S,3aS,6aR)-2-acetamido-N-tert-butyl-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
| SMILES | C=CC[C@H]1[C@@H]2CC(=O)C[C@@H]2C[C@@]1(NC(C)=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H28N2O3/c1-6-7-15-14-9-13(22)8-12(14)10-18(15,19-11(2)21)16(23)20-17(3,4)5/h6,12,14-15H,1,7-10H2,2-5H3,(H,19,21)(H,20,23)/t12-,14-,15+,18+/m1/s1 |
| InChIKey | OTECAPSLHBDLMO-TXPWEPMLSA-N |
| XLogP | 1.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|