C27H34O5Si — CID 155933435
(1S,4S,6R,7S,11S)-10-[(2R)-4-[dimethyl(phenyl)silyl]-2-(2-methyloxiran-2-yl)pent-4-enyl]-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione (PubChem CID 155933435) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is (1S,4S,6R,7S,11S)-10-[(2R)-4-[dimethyl(phenyl)silyl]-2-(2-methyloxiran-2-yl)pent-4-enyl]-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione.
| Compound Name | (1S,4S,6R,7S,11S)-10-[(2R)-4-[dimethyl(phenyl)silyl]-2-(2-methyloxiran-2-yl)pent-4-enyl]-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 155933435 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (1S,4S,6R,7S,11S)-10-[(2R)-4-[dimethyl(phenyl)silyl]-2-(2-methyloxiran-2-yl)pent-4-enyl]-6-hydroxy-6-methyl-3-oxatricyclo[5.3.1.04,11]undec-9-ene-2,8-dione |
| SMILES | C=C(CC(CC1=CC(=O)[C@H]2[C@H]3[C@@H]1C(=O)O[C@H]3C[C@@]2(C)O)C1(C)CO1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H34O5Si/c1-16(33(4,5)19-9-7-6-8-10-19)11-18(27(3)15-31-27)12-17-13-20(28)24-23-21(14-26(24,2)30)32-25(29)22(17)23/h6-10,13,18,21-24,30H,1,11-12,14-15H2,2-5H3/t18?,21-,22+,23+,24-,26+,27?/m0/s1 |
| InChIKey | QKMDMVIBQVGUSK-UNGBONSASA-N |
| XLogP | 3.32 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|