About methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate
methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate (PubChem CID 155933518) has the molecular formula C22H23F6NO2
and a molecular weight of 447.42 g/mol. Its IUPAC name is methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate |
| PubChem CID | 155933518 |
| Molecular Formula | C22H23F6NO2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](C)c1ccc(C(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(C)C)cc1 |
| InChI | InChI=1S/C22H23F6NO2/c1-12(2)19(15-7-5-14(6-8-15)13(3)20(30)31-4)29-18-10-16(21(23,24)25)9-17(11-18)22(26,27)28/h5-13,19,29H,1-4H3/t13-,19?/m0/s1 |
| InChIKey | RSINGFKPMBOBHR-YTJLLHSVSA-N |
| XLogP | 6.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate?
The IUPAC name of methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate (CID 155933518) is methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate.
What is the SMILES notation for methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate?
The canonical SMILES for methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate is COC(=O)[C@@H](C)c1ccc(C(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(C)C)cc1.
What is the InChIKey of methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate?
The InChIKey is RSINGFKPMBOBHR-YTJLLHSVSA-N. The full InChI is InChI=1S/C22H23F6NO2/c1-12(2)19(15-7-5-14(6-8-15)13(3)20(30)31-4)29-18-10-16(21(23,24)25)9-17(11-18)22(26,27)28/h5-13,19,29H,1-4H3/t13-,19?/m0/s1.
What are the key properties of methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate?
methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate has a molecular weight of 447.42 g/mol, XLogP of 6.81, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[4-[1-[3,5-bis(trifluoromethyl)anilino]-2-methylpropyl]phenyl]propanoate is sourced from PubChem (CID 155933518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).