C12H25NO2 — CID 155933610
(3R,4R)-2,2,6,6-tetramethyl-1-propan-2-ylpiperidine-3,4-diol (PubChem CID 155933610) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (3R,4R)-2,2,6,6-tetramethyl-1-propan-2-ylpiperidine-3,4-diol.
| Compound Name | (3R,4R)-2,2,6,6-tetramethyl-1-propan-2-ylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 155933610 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (3R,4R)-2,2,6,6-tetramethyl-1-propan-2-ylpiperidine-3,4-diol |
| SMILES | CC(C)N1C(C)(C)C[C@@H](O)[C@H](O)C1(C)C |
| InChI | InChI=1S/C12H25NO2/c1-8(2)13-11(3,4)7-9(14)10(15)12(13,5)6/h8-10,14-15H,7H2,1-6H3/t9-,10+/m1/s1 |
| InChIKey | UEXVKNMLPVCOBD-ZJUUUORDSA-N |
| XLogP | 1.38 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |