C12H5ClF4N4 — CID 155933745
4-chloro-1-methyl-3-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrazolo[3,4-b]pyridine (PubChem CID 155933745) has the molecular formula C12H5ClF4N4 and a molecular weight of 316.65 g/mol. Its IUPAC name is 4-chloro-1-methyl-3-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrazolo[3,4-b]pyridine.
| Compound Name | 4-chloro-1-methyl-3-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 155933745 |
| Molecular Formula | C12H5ClF4N4 |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 4-chloro-1-methyl-3-(2,3,5,6-tetrafluoro-4-pyridinyl)pyrazolo[3,4-b]pyridine |
| SMILES | Cn1nc(-c2c(F)c(F)nc(F)c2F)c2c(Cl)ccnc21 |
| InChI | InChI=1S/C12H5ClF4N4/c1-21-12-5(4(13)2-3-18-12)9(20-21)6-7(14)10(16)19-11(17)8(6)15/h2-3H,1H3 |
| InChIKey | FMPJJILMHNROPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|