C24H31N3O — CID 155934099
(1S,3S,3aR,6E,9aR)-1,3,9,9-tetramethyl-6-[(4-phenyltriazol-1-yl)methyl]-3,3a,4,5,8,9a-hexahydro-1H-cyclopenta[8]annulen-2-one (PubChem CID 155934099) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (1S,3S,3aR,6E,9aR)-1,3,9,9-tetramethyl-6-[(4-phenyltriazol-1-yl)methyl]-3,3a,4,5,8,9a-hexahydro-1H-cyclopenta[8]annulen-2-one.
| Compound Name | (1S,3S,3aR,6E,9aR)-1,3,9,9-tetramethyl-6-[(4-phenyltriazol-1-yl)methyl]-3,3a,4,5,8,9a-hexahydro-1H-cyclopenta[8]annulen-2-one |
|---|---|
| PubChem CID | 155934099 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (1S,3S,3aR,6E,9aR)-1,3,9,9-tetramethyl-6-[(4-phenyltriazol-1-yl)methyl]-3,3a,4,5,8,9a-hexahydro-1H-cyclopenta[8]annulen-2-one |
| SMILES | C[C@@H]1C(=O)[C@@H](C)[C@H]2[C@H]1CC/C(Cn1cc(-c3ccccc3)nn1)=C\CC2(C)C |
| InChI | InChI=1S/C24H31N3O/c1-16-20-11-10-18(12-13-24(3,4)22(20)17(2)23(16)28)14-27-15-21(25-26-27)19-8-6-5-7-9-19/h5-9,12,15-17,20,22H,10-11,13-14H2,1-4H3/b18-12+/t16-,17-,20-,22-/m0/s1 |
| InChIKey | NAHOMUNFJAHUPK-NYUQCQMDSA-N |
| XLogP | 5.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|