About tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane
tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane (PubChem CID 155934177) has the molecular formula C11H22Br2OSi
and a molecular weight of 358.19 g/mol. Its IUPAC name is tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane |
| PubChem CID | 155934177 |
| Molecular Formula | C11H22Br2OSi |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(Br)=C\CCBr |
| InChI | InChI=1S/C11H22Br2OSi/c1-11(2,3)15(4,5)14-9-10(13)7-6-8-12/h7H,6,8-9H2,1-5H3/b10-7+ |
| InChIKey | RJAHMBJZXKVTKL-JXMROGBWSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane (CID 155934177) is tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane is CC(C)(C)[Si](C)(C)OC/C(Br)=C\CCBr.
What is the InChIKey of tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane?
The InChIKey is RJAHMBJZXKVTKL-JXMROGBWSA-N. The full InChI is InChI=1S/C11H22Br2OSi/c1-11(2,3)15(4,5)14-9-10(13)7-6-8-12/h7H,6,8-9H2,1-5H3/b10-7+.
What are the key properties of tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane?
tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane has a molecular weight of 358.19 g/mol, XLogP of 5.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E)-2,5-dibromopent-2-enoxy]-dimethylsilane is sourced from PubChem (CID 155934177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).