About 4-amino-3,5-difluorobenzenesulfonamide
4-amino-3,5-difluorobenzenesulfonamide (PubChem CID 155934233) has the molecular formula C6H6F2N2O2S
and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-amino-3,5-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-3,5-difluorobenzenesulfonamide |
| PubChem CID | 155934233 |
| Molecular Formula | C6H6F2N2O2S |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 4-amino-3,5-difluorobenzenesulfonamide |
| SMILES | Nc1c(F)cc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C6H6F2N2O2S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H2,10,11,12) |
| InChIKey | DIZHXFXCIIAOSN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5-difluorobenzenesulfonamide?
The IUPAC name of 4-amino-3,5-difluorobenzenesulfonamide (CID 155934233) is 4-amino-3,5-difluorobenzenesulfonamide.
What is the SMILES notation for 4-amino-3,5-difluorobenzenesulfonamide?
The canonical SMILES for 4-amino-3,5-difluorobenzenesulfonamide is Nc1c(F)cc(S(N)(=O)=O)cc1F.
What is the InChIKey of 4-amino-3,5-difluorobenzenesulfonamide?
The InChIKey is DIZHXFXCIIAOSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H2,10,11,12).
What are the key properties of 4-amino-3,5-difluorobenzenesulfonamide?
4-amino-3,5-difluorobenzenesulfonamide has a molecular weight of 208.19 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-difluorobenzenesulfonamide is sourced from PubChem (CID 155934233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).