C18H18BF3O2 — CID 155934279
5,5-dimethyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborinane (PubChem CID 155934279) has the molecular formula C18H18BF3O2 and a molecular weight of 334.15 g/mol. Its IUPAC name is 5,5-dimethyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 155934279 |
| Molecular Formula | C18H18BF3O2 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5,5-dimethyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)OC1 |
| InChI | InChI=1S/C18H18BF3O2/c1-17(2)11-23-19(24-12-17)16-9-5-14(6-10-16)13-3-7-15(8-4-13)18(20,21)22/h3-10H,11-12H2,1-2H3 |
| InChIKey | OQKPDUUUDCQKMF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|