C24H27BClNO2 — CID 155934374
2-[1-(3-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-8-methylquinoline (PubChem CID 155934374) has the molecular formula C24H27BClNO2 and a molecular weight of 407.75 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-8-methylquinoline.
| Compound Name | 2-[1-(3-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-8-methylquinoline |
|---|---|
| PubChem CID | 155934374 |
| Molecular Formula | C24H27BClNO2 |
| Molecular Weight | 407.75 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-8-methylquinoline |
| SMILES | Cc1cccc2ccc(C(CB3OC(C)(C)C(C)(C)O3)c3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C24H27BClNO2/c1-16-8-6-9-17-12-13-21(27-22(16)17)20(18-10-7-11-19(26)14-18)15-25-28-23(2,3)24(4,5)29-25/h6-14,20H,15H2,1-5H3 |
| InChIKey | GFFIRSKIFLHJEB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.75 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|