C11H16O3 — CID 155934540
(3aR,7aS)-7a-methylspiro[3,3a,4,5-tetrahydrofuro[2,3-b]pyran-6,1'-cyclobutane]-2-one (PubChem CID 155934540) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3aR,7aS)-7a-methylspiro[3,3a,4,5-tetrahydrofuro[2,3-b]pyran-6,1'-cyclobutane]-2-one.
| Compound Name | (3aR,7aS)-7a-methylspiro[3,3a,4,5-tetrahydrofuro[2,3-b]pyran-6,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 155934540 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3aR,7aS)-7a-methylspiro[3,3a,4,5-tetrahydrofuro[2,3-b]pyran-6,1'-cyclobutane]-2-one |
| SMILES | C[C@]12OC(=O)C[C@H]1CCC1(CCC1)O2 |
| InChI | InChI=1S/C11H16O3/c1-10-8(7-9(12)13-10)3-6-11(14-10)4-2-5-11/h8H,2-7H2,1H3/t8-,10-/m1/s1 |
| InChIKey | XURPYLMTVVQNSG-PSASIEDQSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |