C13H11BrF3N — CID 155934568
6-bromo-9-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazole (PubChem CID 155934568) has the molecular formula C13H11BrF3N and a molecular weight of 318.14 g/mol. Its IUPAC name is 6-bromo-9-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 6-bromo-9-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 155934568 |
| Molecular Formula | C13H11BrF3N |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 6-bromo-9-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazole |
| SMILES | FC(F)(F)n1c2c(c3cc(Br)ccc31)CCCC2 |
| InChI | InChI=1S/C13H11BrF3N/c14-8-5-6-12-10(7-8)9-3-1-2-4-11(9)18(12)13(15,16)17/h5-7H,1-4H2 |
| InChIKey | PHDPIIUSWIHVJR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |