About 2-butyl-3,4-dichloro-2H-furan-5-one
2-butyl-3,4-dichloro-2H-furan-5-one (PubChem CID 155934790) has the molecular formula C8H10Cl2O2
and a molecular weight of 209.07 g/mol. Its IUPAC name is 2-butyl-3,4-dichloro-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-butyl-3,4-dichloro-2H-furan-5-one |
| PubChem CID | 155934790 |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 2-butyl-3,4-dichloro-2H-furan-5-one |
| SMILES | CCCCC1OC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H10Cl2O2/c1-2-3-4-5-6(9)7(10)8(11)12-5/h5H,2-4H2,1H3 |
| InChIKey | QDHDSSGZPXBRFY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-3,4-dichloro-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,4-dichloro-2H-furan-5-one?
The IUPAC name of 2-butyl-3,4-dichloro-2H-furan-5-one (CID 155934790) is 2-butyl-3,4-dichloro-2H-furan-5-one.
What is the SMILES notation for 2-butyl-3,4-dichloro-2H-furan-5-one?
The canonical SMILES for 2-butyl-3,4-dichloro-2H-furan-5-one is CCCCC1OC(=O)C(Cl)=C1Cl.
What is the InChIKey of 2-butyl-3,4-dichloro-2H-furan-5-one?
The InChIKey is QDHDSSGZPXBRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2O2/c1-2-3-4-5-6(9)7(10)8(11)12-5/h5H,2-4H2,1H3.
What are the key properties of 2-butyl-3,4-dichloro-2H-furan-5-one?
2-butyl-3,4-dichloro-2H-furan-5-one has a molecular weight of 209.07 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,4-dichloro-2H-furan-5-one is sourced from PubChem (CID 155934790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).