C23H42O3Si — CID 155935117
(3aS,4S,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one (PubChem CID 155935117) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is (3aS,4S,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one.
| Compound Name | (3aS,4S,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 155935117 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (3aS,4S,5aR,7S,9aS,9bR)-7-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]3CCC(=O)[C@]3(C)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C23H42O3Si/c1-20(2,3)27(8,9)26-19-12-13-22(6)15-10-11-17(24)23(15,7)18(25)14-16(22)21(19,4)5/h15-16,18-19,25H,10-14H2,1-9H3/t15-,16+,18+,19+,22-,23-/m1/s1 |
| InChIKey | BZHPXSVAMYHTOT-ZJMHZRMMSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|