About [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate
[(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate (PubChem CID 155935612) has the molecular formula C11H10F3NO3S
and a molecular weight of 293.27 g/mol. Its IUPAC name is [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate |
| PubChem CID | 155935612 |
| Molecular Formula | C11H10F3NO3S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](C#N)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO3S/c1-8-2-4-10(5-3-8)19(16,17)18-9(7-15)6-11(12,13)14/h2-5,9H,6H2,1H3/t9-/m1/s1 |
| InChIKey | TXWYWYCJGMUAAR-SECBINFHSA-N |
| XLogP | 2.54 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate?
The IUPAC name of [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate (CID 155935612) is [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[C@@H](C#N)CC(F)(F)F)cc1.
What is the InChIKey of [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate?
The InChIKey is TXWYWYCJGMUAAR-SECBINFHSA-N. The full InChI is InChI=1S/C11H10F3NO3S/c1-8-2-4-10(5-3-8)19(16,17)18-9(7-15)6-11(12,13)14/h2-5,9H,6H2,1H3/t9-/m1/s1.
What are the key properties of [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate?
[(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate has a molecular weight of 293.27 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyano-3,3,3-trifluoropropyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 155935612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).