C16H28S — CID 155935613
(2E,6E,10E)-2,6,10-trimethyl-1-methylsulfanyldodeca-2,6,10-triene (PubChem CID 155935613) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is (2E,6E,10E)-2,6,10-trimethyl-1-methylsulfanyldodeca-2,6,10-triene.
| Compound Name | (2E,6E,10E)-2,6,10-trimethyl-1-methylsulfanyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 155935613 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (2E,6E,10E)-2,6,10-trimethyl-1-methylsulfanyldodeca-2,6,10-triene |
| SMILES | C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CSC |
| InChI | InChI=1S/C16H28S/c1-6-14(2)9-7-10-15(3)11-8-12-16(4)13-17-5/h6,10,12H,7-9,11,13H2,1-5H3/b14-6+,15-10+,16-12+ |
| InChIKey | BLENFPIEBPQFKU-VVZZWEIHSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|