About (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile
(2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile (PubChem CID 155935723) has the molecular formula C11H10F3NO
and a molecular weight of 229.20 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile.
Molecular Properties
| Compound Name | (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile |
| PubChem CID | 155935723 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile |
| SMILES | N#C[C@@H](CC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C11H10F3NO/c12-11(13,14)6-10(7-15)16-8-9-4-2-1-3-5-9/h1-5,10H,6,8H2/t10-/m1/s1 |
| InChIKey | UXPMUIOSDHQVBO-SNVBAGLBSA-N |
| XLogP | 3.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile?
The IUPAC name of (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile (CID 155935723) is (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile.
What is the SMILES notation for (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile?
The canonical SMILES for (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile is N#C[C@@H](CC(F)(F)F)OCc1ccccc1.
What is the InChIKey of (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile?
The InChIKey is UXPMUIOSDHQVBO-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H10F3NO/c12-11(13,14)6-10(7-15)16-8-9-4-2-1-3-5-9/h1-5,10H,6,8H2/t10-/m1/s1.
What are the key properties of (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile?
(2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile has a molecular weight of 229.20 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4,4-trifluoro-2-phenylmethoxybutanenitrile is sourced from PubChem (CID 155935723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).