C16H16F12O4 — CID 155935754
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(4,4-dimethyl-6-oxooxan-2-yl)acetate (PubChem CID 155935754) has the molecular formula C16H16F12O4 and a molecular weight of 500.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(4,4-dimethyl-6-oxooxan-2-yl)acetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(4,4-dimethyl-6-oxooxan-2-yl)acetate |
|---|---|
| PubChem CID | 155935754 |
| Molecular Formula | C16H16F12O4 |
| Molecular Weight | 500.28 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(4,4-dimethyl-6-oxooxan-2-yl)acetate |
| SMILES | CC1(C)CC(=O)OC(CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C16H16F12O4/c1-11(2)4-7(32-9(30)5-11)3-8(29)31-6-12(19,20)14(23,24)16(27,28)15(25,26)13(21,22)10(17)18/h7,10H,3-6H2,1-2H3 |
| InChIKey | XANITHYBMQTIMV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|