C14H14N2O6 — CID 155935830
dimethyl (4S,5S)-3-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate (PubChem CID 155935830) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is dimethyl (4S,5S)-3-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5S)-3-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 155935830 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | dimethyl (4S,5S)-3-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(/C(=N\O)c2ccccc2)=NO[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H14N2O6/c1-20-13(17)9-11(16-22-12(9)14(18)21-2)10(15-19)8-6-4-3-5-7-8/h3-7,9,12,19H,1-2H3/b15-10-/t9-,12-/m0/s1 |
| InChIKey | SXJVSGGOWZBUSE-USPPKXLHSA-N |
| XLogP | 0.58 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|