C23H23NO2 — CID 155935876
N-(1-hydroxy-1,1,3-triphenylpropan-2-yl)acetamide (PubChem CID 155935876) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(1-hydroxy-1,1,3-triphenylpropan-2-yl)acetamide.
| Compound Name | N-(1-hydroxy-1,1,3-triphenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 155935876 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(1-hydroxy-1,1,3-triphenylpropan-2-yl)acetamide |
| SMILES | CC(=O)NC(Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-18(25)24-22(17-19-11-5-2-6-12-19)23(26,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22,26H,17H2,1H3,(H,24,25) |
| InChIKey | UAHUPHIAEMWQGU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |