About (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane]
(3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] (PubChem CID 155936191) has the molecular formula C26H26O2
and a molecular weight of 370.49 g/mol. Its IUPAC name is (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane].
Molecular Properties
| Compound Name | (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] |
| PubChem CID | 155936191 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] |
| SMILES | c1ccc(CC2(Cc3ccccc3)O[C@]3(CCCCO3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H26O2/c1-3-11-21(12-4-1)19-25(20-22-13-5-2-6-14-22)23-15-7-8-16-24(23)26(28-25)17-9-10-18-27-26/h1-8,11-16H,9-10,17-20H2/t26-/m1/s1 |
| InChIKey | HPIJBEMMPCBFOK-AREMUKBSSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane]?
The IUPAC name of (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] (CID 155936191) is (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane].
What is the SMILES notation for (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane]?
The canonical SMILES for (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] is c1ccc(CC2(Cc3ccccc3)O[C@]3(CCCCO3)c3ccccc32)cc1.
What is the InChIKey of (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane]?
The InChIKey is HPIJBEMMPCBFOK-AREMUKBSSA-N. The full InChI is InChI=1S/C26H26O2/c1-3-11-21(12-4-1)19-25(20-22-13-5-2-6-14-22)23-15-7-8-16-24(23)26(28-25)17-9-10-18-27-26/h1-8,11-16H,9-10,17-20H2/t26-/m1/s1.
What are the key properties of (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane]?
(3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] has a molecular weight of 370.49 g/mol, XLogP of 5.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,1-dibenzylspiro[2-benzofuran-3,2'-oxane] is sourced from PubChem (CID 155936191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).