About 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole
5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole (PubChem CID 155936256) has the molecular formula C29H29NO2S
and a molecular weight of 455.62 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole.
Molecular Properties
| Compound Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole |
| PubChem CID | 155936256 |
| Molecular Formula | C29H29NO2S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole |
| SMILES | CCCc1c2c(c3ccccc3c1C)N(S(=O)(=O)c1ccc(C)cc1)C(c1ccccc1)C2 |
| InChI | InChI=1S/C29H29NO2S/c1-4-10-24-21(3)25-13-8-9-14-26(25)29-27(24)19-28(22-11-6-5-7-12-22)30(29)33(31,32)23-17-15-20(2)16-18-23/h5-9,11-18,28H,4,10,19H2,1-3H3 |
| InChIKey | UJRJKPIKFOHYQD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole?
The IUPAC name of 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole (CID 155936256) is 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole.
What is the SMILES notation for 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole?
The canonical SMILES for 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole is CCCc1c2c(c3ccccc3c1C)N(S(=O)(=O)c1ccc(C)cc1)C(c1ccccc1)C2.
What is the InChIKey of 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole?
The InChIKey is UJRJKPIKFOHYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29NO2S/c1-4-10-24-21(3)25-13-8-9-14-26(25)29-27(24)19-28(22-11-6-5-7-12-22)30(29)33(31,32)23-17-15-20(2)16-18-23/h5-9,11-18,28H,4,10,19H2,1-3H3.
What are the key properties of 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole?
5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole has a molecular weight of 455.62 g/mol, XLogP of 6.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-propyl-2,3-dihydrobenzo[g]indole is sourced from PubChem (CID 155936256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).